C22H29FIN7 — CID 111994894
1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111994894) has the molecular formula C22H29FIN7 and a molecular weight of 537.43 g/mol. Its IUPAC name is 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994894 |
| Molecular Formula | C22H29FIN7 |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nnc2ccccn12)NC1CCCN(c2cc(C)ccc2F)C1.I |
| InChI | InChI=1S/C22H28FN7.HI/c1-16-8-9-18(23)19(14-16)29-12-5-6-17(15-29)26-22(24-2)25-11-10-21-28-27-20-7-3-4-13-30(20)21;/h3-4,7-9,13-14,17H,5-6,10-12,15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | PIYRSPUVLAMUET-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|