C23H31FIN5O2 — CID 111995676
2-[3-[[[N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111995676) has the molecular formula C23H31FIN5O2 and a molecular weight of 555.44 g/mol. Its IUPAC name is 2-[3-[[[N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111995676 |
| Molecular Formula | C23H31FIN5O2 |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-[3-[[[N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)NC1CCCN(c2cc(C)ccc2F)C1.I |
| InChI | InChI=1S/C23H30FN5O2.HI/c1-16-8-9-20(24)21(11-16)29-10-4-6-18(14-29)28-23(26-2)27-13-17-5-3-7-19(12-17)31-15-22(25)30;/h3,5,7-9,11-12,18H,4,6,10,13-15H2,1-2H3,(H2,25,30)(H2,26,27,28);1H |
| InChIKey | XDLJAPJCOGWFCF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|