C21H34IN5O3 — CID 111996440
2-[3-[[[N'-methyl-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111996440) has the molecular formula C21H34IN5O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N'-methyl-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111996440 |
| Molecular Formula | C21H34IN5O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)NC1CCN(CC2CCOC2)CC1.I |
| InChI | InChI=1S/C21H33N5O3.HI/c1-23-21(24-12-16-3-2-4-19(11-16)29-15-20(22)27)25-18-5-8-26(9-6-18)13-17-7-10-28-14-17;/h2-4,11,17-18H,5-10,12-15H2,1H3,(H2,22,27)(H2,23,24,25);1H |
| InChIKey | RLLICQQMGPKQMG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|