C20H24ClFN4O2S — CID 109462606
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(2-fluorophenyl)sulfonylethyl]-2-methylguanidine (PubChem CID 109462606) has the molecular formula C20H24ClFN4O2S and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(2-fluorophenyl)sulfonylethyl]-2-methylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(2-fluorophenyl)sulfonylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109462606 |
| Molecular Formula | C20H24ClFN4O2S |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(2-fluorophenyl)sulfonylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1F)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H24ClFN4O2S/c1-23-20(24-10-12-29(27,28)19-8-3-2-7-18(19)22)25-16-9-11-26(14-16)17-6-4-5-15(21)13-17/h2-8,13,16H,9-12,14H2,1H3,(H2,23,24,25) |
| InChIKey | LGJHYUIUANDPKZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|