C19H23ClFIN4O — CID 109463283
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109463283) has the molecular formula C19H23ClFIN4O and a molecular weight of 504.78 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109463283 |
| Molecular Formula | C19H23ClFIN4O |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(O)c(F)c1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C19H22ClFN4O.HI/c1-22-19(23-11-13-5-6-18(26)17(21)9-13)24-15-7-8-25(12-15)16-4-2-3-14(20)10-16;/h2-6,9-10,15,26H,7-8,11-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | GEZAVXUJPKHSNV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|