C22H28ClIN4O3 — CID 109464013
methyl 4-[[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 109464013) has the molecular formula C22H28ClIN4O3 and a molecular weight of 558.85 g/mol. Its IUPAC name is methyl 4-[[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 4-[[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 109464013 |
| Molecular Formula | C22H28ClIN4O3 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | methyl 4-[[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)OC)c(OC)c1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C22H27ClN4O3.HI/c1-24-22(25-13-15-7-8-19(21(28)30-3)20(11-15)29-2)26-17-9-10-27(14-17)18-6-4-5-16(23)12-18;/h4-8,11-12,17H,9-10,13-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | XMKXWTIGFYFZOS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|