C23H36FIN6 — CID 109404990
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide (PubChem CID 109404990) has the molecular formula C23H36FIN6 and a molecular weight of 542.49 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109404990 |
| Molecular Formula | C23H36FIN6 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NC1CCN(Cc2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C23H35FN6.HI/c1-5-21-20(22(6-2)29(4)28-21)15-26-23(25-3)27-19-11-13-30(14-12-19)16-17-7-9-18(24)10-8-17;/h7-10,19H,5-6,11-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | FYTDPAWGIQMMIU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|