C24H41N5O — CID 111978070
2-[4-[[N'-[(4-tert-butylphenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 111978070) has the molecular formula C24H41N5O and a molecular weight of 415.63 g/mol. Its IUPAC name is 2-[4-[[N'-[(4-tert-butylphenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[[N'-[(4-tert-butylphenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 111978070 |
| Molecular Formula | C24H41N5O |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 2-[4-[[N'-[(4-tert-butylphenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/Cc2ccc(C(C)(C)C)cc2)NCC)CC1 |
| InChI | InChI=1S/C24H41N5O/c1-6-14-26-22(30)18-29-15-12-21(13-16-29)28-23(25-7-2)27-17-19-8-10-20(11-9-19)24(3,4)5/h8-11,21H,6-7,12-18H2,1-5H3,(H,26,30)(H2,25,27,28) |
| InChIKey | RAWNBSLDIOXQCT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|