C22H37N3O — CID 131963012
2-[4-[2-(4-tert-butylphenyl)ethylamino]piperidin-1-yl]-N-propylacetamide (PubChem CID 131963012) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is 2-[4-[2-(4-tert-butylphenyl)ethylamino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[2-(4-tert-butylphenyl)ethylamino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 131963012 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | 2-[4-[2-(4-tert-butylphenyl)ethylamino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(NCCc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H37N3O/c1-5-13-24-21(26)17-25-15-11-20(12-16-25)23-14-10-18-6-8-19(9-7-18)22(2,3)4/h6-9,20,23H,5,10-17H2,1-4H3,(H,24,26) |
| InChIKey | QQHLIWCNOIVDNQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |