C15H24BrN3OS — CID 38065184
2-[4-[(5-bromothiophen-3-yl)methylamino]piperidin-1-yl]-N-propylacetamide (PubChem CID 38065184) has the molecular formula C15H24BrN3OS and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-3-yl)methylamino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[(5-bromothiophen-3-yl)methylamino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 38065184 |
| Molecular Formula | C15H24BrN3OS |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[4-[(5-bromothiophen-3-yl)methylamino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(NCc2csc(Br)c2)CC1 |
| InChI | InChI=1S/C15H24BrN3OS/c1-2-5-17-15(20)10-19-6-3-13(4-7-19)18-9-12-8-14(16)21-11-12/h8,11,13,18H,2-7,9-10H2,1H3,(H,17,20) |
| InChIKey | DPMWATGJKFIYAE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |