C19H31BrIN5O — CID 111978061
2-[4-[[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide;hydroiodide (PubChem CID 111978061) has the molecular formula C19H31BrIN5O and a molecular weight of 552.30 g/mol. Its IUPAC name is 2-[4-[[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[4-[[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111978061 |
| Molecular Formula | C19H31BrIN5O |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[4-[[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/C)NCc2ccc(Br)cc2)CC1.I |
| InChI | InChI=1S/C19H30BrN5O.HI/c1-3-10-22-18(26)14-25-11-8-17(9-12-25)24-19(21-2)23-13-15-4-6-16(20)7-5-15;/h4-7,17H,3,8-14H2,1-2H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | ULSAYWKMQUNDJR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|