C18H37IN6O2 — CID 111990748
2-methyl-N-[2-[[N'-methyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide (PubChem CID 111990748) has the molecular formula C18H37IN6O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111990748 |
| Molecular Formula | C18H37IN6O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/C)NCCNC(=O)C(C)C)CC1.I |
| InChI | InChI=1S/C18H36N6O2.HI/c1-5-8-20-16(25)13-24-11-6-15(7-12-24)23-18(19-4)22-10-9-21-17(26)14(2)3;/h14-15H,5-13H2,1-4H3,(H,20,25)(H,21,26)(H2,19,22,23);1H |
| InChIKey | NKBPBOCZJNHUTG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|