C15H30N4O2 — CID 119853535
2-methyl-3-(methylamino)-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide (PubChem CID 119853535) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 119853535 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)C(C)CNC)CC1 |
| InChI | InChI=1S/C15H30N4O2/c1-4-7-17-14(20)11-19-8-5-13(6-9-19)18-15(21)12(2)10-16-3/h12-13,16H,4-11H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | BAPADFREQJUPKD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |