C20H29FN6O — CID 111992753
2-[4-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 111992753) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[4-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 111992753 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[4-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/C)NCc2cc(C#N)ccc2F)CC1 |
| InChI | InChI=1S/C20H29FN6O/c1-3-8-24-19(28)14-27-9-6-17(7-10-27)26-20(23-2)25-13-16-11-15(12-22)4-5-18(16)21/h4-5,11,17H,3,6-10,13-14H2,1-2H3,(H,24,28)(H2,23,25,26) |
| InChIKey | HCFQSNPNBWVFLR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|