C23H27F2N5O — CID 111993239
1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylguanidine (PubChem CID 111993239) has the molecular formula C23H27F2N5O and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylguanidine.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111993239 |
| Molecular Formula | C23H27F2N5O |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc(C#N)ccc1F)NC1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27F2N5O/c1-27-23(28-14-18-11-16(13-26)3-5-20(18)24)29-19-7-9-30(10-8-19)15-17-4-6-22(31-2)21(25)12-17/h3-6,11-12,19H,7-10,14-15H2,1-2H3,(H2,27,28,29) |
| InChIKey | KZMWUXWSRHCLBY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|