C17H27IN6O2 — CID 119157167
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide (PubChem CID 119157167) has the molecular formula C17H27IN6O2 and a molecular weight of 474.35 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119157167 |
| Molecular Formula | C17H27IN6O2 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/C)NCC(C)(O)c1ccco1)CC2.I |
| InChI | InChI=1S/C17H26N6O2.HI/c1-4-14-21-15-8-7-12(10-23(15)22-14)20-16(18-3)19-11-17(2,24)13-6-5-9-25-13;/h5-6,9,12,24H,4,7-8,10-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | HADYQVZLOVWONH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|