C19H32N6O — CID 119162396
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylguanidine (PubChem CID 119162396) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylguanidine.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 119162396 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylguanidine |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/C)NC1C3CCCOC3C1(C)C)CC2 |
| InChI | InChI=1S/C19H32N6O/c1-5-14-22-15-9-8-12(11-25(15)24-14)21-18(20-4)23-16-13-7-6-10-26-17(13)19(16,2)3/h12-13,16-17H,5-11H2,1-4H3,(H2,20,21,23) |
| InChIKey | WTVAXHVPOYJXRJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|