C20H32N6O — CID 109405615
2-ethyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine (PubChem CID 109405615) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-ethyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine.
| Compound Name | 2-ethyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
|---|---|
| PubChem CID | 109405615 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-ethyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
| SMILES | CC/N=C(\NC1CCc2nc(C)nn2C1)NC1C2CCOC2C12CCCC2 |
| InChI | InChI=1S/C20H32N6O/c1-3-21-19(23-14-6-7-16-22-13(2)25-26(16)12-14)24-17-15-8-11-27-18(15)20(17)9-4-5-10-20/h14-15,17-18H,3-12H2,1-2H3,(H2,21,23,24) |
| InChIKey | AKTUMBJJGWHRGR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|