C19H30F3N3O — CID 109393942
2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-3-[4-(trifluoromethyl)cyclohexyl]guanidine (PubChem CID 109393942) has the molecular formula C19H30F3N3O and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-3-[4-(trifluoromethyl)cyclohexyl]guanidine.
| Compound Name | 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 109393942 |
| Molecular Formula | C19H30F3N3O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
| SMILES | CC/N=C(\NC1CCC(C(F)(F)F)CC1)NC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C19H30F3N3O/c1-2-23-17(24-13-6-4-12(5-7-13)19(20,21)22)25-15-14-8-11-26-16(14)18(15)9-3-10-18/h12-16H,2-11H2,1H3,(H2,23,24,25) |
| InChIKey | ZPWFQYGIEXMWRX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|