C19H34IN3O — CID 109395459
1-(4,4-dimethylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide (PubChem CID 109395459) has the molecular formula C19H34IN3O and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109395459 |
| Molecular Formula | C19H34IN3O |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
| SMILES | C/N=C(\NC1CCC(C)(C)CC1)NC1C2CCOC2C12CCC2.I |
| InChI | InChI=1S/C19H33N3O.HI/c1-18(2)10-5-13(6-11-18)21-17(20-3)22-15-14-7-12-23-16(14)19(15)8-4-9-19;/h13-16H,4-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | DLCGABZDERECEJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|