C16H30IN3O — CID 109391423
2-methyl-1-pentyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide (PubChem CID 109391423) has the molecular formula C16H30IN3O and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-methyl-1-pentyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-pentyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109391423 |
| Molecular Formula | C16H30IN3O |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-methyl-1-pentyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NC1C2CCOC2C12CCC2.I |
| InChI | InChI=1S/C16H29N3O.HI/c1-3-4-5-10-18-15(17-2)19-13-12-7-11-20-14(12)16(13)8-6-9-16;/h12-14H,3-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | UXQOTVLBIPQMJP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|