C14H23N3O — CID 109391262
2-methyl-1-prop-2-enyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine (PubChem CID 109391262) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine.
| Compound Name | 2-methyl-1-prop-2-enyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
|---|---|
| PubChem CID | 109391262 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
| SMILES | C=CCN/C(=N\C)NC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C14H23N3O/c1-3-8-16-13(15-2)17-11-10-5-9-18-12(10)14(11)6-4-7-14/h3,10-12H,1,4-9H2,2H3,(H2,15,16,17) |
| InChIKey | UXHDGICGEUKDEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|