C22H34IN3O4 — CID 109401228
2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 109401228) has the molecular formula C22H34IN3O4 and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109401228 |
| Molecular Formula | C22H34IN3O4 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-ethyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | CC/N=C(\Nc1cc(OC)c(OC)c(OC)c1)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C22H33N3O4.HI/c1-5-23-21(24-14-12-16(26-2)18(28-4)17(13-14)27-3)25-19-15-8-11-29-20(15)22(19)9-6-7-10-22;/h12-13,15,19-20H,5-11H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | LTWBUEQEWFKDMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|