C14H25IN6 — CID 119159073
2-methyl-1-(2-methylcyclopropyl)-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 119159073) has the molecular formula C14H25IN6 and a molecular weight of 404.30 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119159073 |
| Molecular Formula | C14H25IN6 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCc2nnc(C)n2C1)NC1CC1C.I |
| InChI | InChI=1S/C14H24N6.HI/c1-9-6-12(9)17-14(15-3)16-7-11-4-5-13-19-18-10(2)20(13)8-11;/h9,11-12H,4-8H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | QUQIJTPDPMZLDE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|