C18H25FN6S — CID 119158201
1-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine (PubChem CID 119158201) has the molecular formula C18H25FN6S and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine.
| Compound Name | 1-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119158201 |
| Molecular Formula | C18H25FN6S |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(F)ccc1SC)NCC1CCc2nnc(C)n2C1 |
| InChI | InChI=1S/C18H25FN6S/c1-12-23-24-17-7-4-13(11-25(12)17)9-21-18(20-2)22-10-14-8-15(19)5-6-16(14)26-3/h5-6,8,13H,4,7,9-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | IFRKYPORKGJERU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|