C18H25F2IN6 — CID 119159003
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 119159003) has the molecular formula C18H25F2IN6 and a molecular weight of 490.34 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119159003 |
| Molecular Formula | C18H25F2IN6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC1CCc2nnc(C)n2C1.I |
| InChI | InChI=1S/C18H24F2N6.HI/c1-3-21-18(23-10-14-8-15(19)5-6-16(14)20)22-9-13-4-7-17-25-24-12(2)26(17)11-13;/h5-6,8,13H,3-4,7,9-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OIOWTWLQQCHAOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|