C17H26F2N4 — CID 111903073
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(1-methylpiperidin-4-yl)methyl]guanidine (PubChem CID 111903073) has the molecular formula C17H26F2N4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(1-methylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(1-methylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111903073 |
| Molecular Formula | C17H26F2N4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(1-methylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC1CCN(C)CC1 |
| InChI | InChI=1S/C17H26F2N4/c1-3-20-17(21-11-13-6-8-23(2)9-7-13)22-12-14-10-15(18)4-5-16(14)19/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | DRSNVFSISZWSRT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|