C16H24F2N4O2S — CID 111903269
2-[(2,5-difluorophenyl)methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine (PubChem CID 111903269) has the molecular formula C16H24F2N4O2S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111903269 |
| Molecular Formula | C16H24F2N4O2S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H24F2N4O2S/c1-2-19-16(21-12-13-11-14(17)3-4-15(13)18)20-5-6-22-7-9-25(23,24)10-8-22/h3-4,11H,2,5-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | BERPEWXVKVQZPB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|