C17H26F2N4O3S — CID 111866296
2-[[2-(difluoromethoxy)phenyl]methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine (PubChem CID 111866296) has the molecular formula C17H26F2N4O3S and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111866296 |
| Molecular Formula | C17H26F2N4O3S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H26F2N4O3S/c1-2-20-17(21-7-8-23-9-11-27(24,25)12-10-23)22-13-14-5-3-4-6-15(14)26-16(18)19/h3-6,16H,2,7-13H2,1H3,(H2,20,21,22) |
| InChIKey | LFIOLUXQPKLHLL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|