C20H33F2N5O — CID 111866328
2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111866328) has the molecular formula C20H33F2N5O and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111866328 |
| Molecular Formula | C20H33F2N5O |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C20H33F2N5O/c1-3-23-20(24-10-6-12-27-13-7-11-26(2)14-15-27)25-16-17-8-4-5-9-18(17)28-19(21)22/h4-5,8-9,19H,3,6-7,10-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | CPQGQYZKDNSAPK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|