C14H23IN6 — CID 119158957
1-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 119158957) has the molecular formula C14H23IN6 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119158957 |
| Molecular Formula | C14H23IN6 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CC1CCc2nnc(C)n2C1)NCC.I |
| InChI | InChI=1S/C14H22N6.HI/c1-4-8-16-14(15-5-2)17-9-12-6-7-13-19-18-11(3)20(13)10-12;/h1,12H,5-10H2,2-3H3,(H2,15,16,17);1H |
| InChIKey | LJAOLPNNOMGCPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|