C21H38IN7 — CID 119158332
1-(1-cyclopentylpiperidin-4-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 119158332) has the molecular formula C21H38IN7 and a molecular weight of 515.49 g/mol. Its IUPAC name is 1-(1-cyclopentylpiperidin-4-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-cyclopentylpiperidin-4-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119158332 |
| Molecular Formula | C21H38IN7 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 1-(1-cyclopentylpiperidin-4-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCc2nnc(C)n2C1)NC1CCN(C2CCCC2)CC1.I |
| InChI | InChI=1S/C21H37N7.HI/c1-3-22-21(23-14-17-8-9-20-26-25-16(2)28(20)15-17)24-18-10-12-27(13-11-18)19-6-4-5-7-19;/h17-19H,3-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | KWVMEGIUNZVUJT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|