C17H29N7O — CID 119157751
4-acetyl-N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide (PubChem CID 119157751) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119157751 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCc2nnc(C)n2C1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C17H29N7O/c1-4-18-17(23-9-7-22(8-10-23)14(3)25)19-11-15-5-6-16-21-20-13(2)24(16)12-15/h15H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | SQCCCDQFPOILFU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|