C23H32N6 — CID 119159170
N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboximidamide (PubChem CID 119159170) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboximidamide |
|---|---|
| PubChem CID | 119159170 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-ethyl-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCc2nnc(C)n2C1)N1CC2(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C23H32N6/c1-3-24-22(25-14-18-10-11-21-27-26-17(2)28(21)15-18)29-16-23(12-6-7-13-23)19-8-4-5-9-20(19)29/h4-5,8-9,18H,3,6-7,10-16H2,1-2H3,(H,24,25) |
| InChIKey | MELWFBBOODMUQM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|