C19H33N7O — CID 119158019
N-ethyl-4-(2-methylpropanoyl)-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide (PubChem CID 119158019) has the molecular formula C19H33N7O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-ethyl-4-(2-methylpropanoyl)-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-methylpropanoyl)-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119158019 |
| Molecular Formula | C19H33N7O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-ethyl-4-(2-methylpropanoyl)-N'-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCc2nnc(C)n2C1)N1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C19H33N7O/c1-5-20-19(25-10-8-24(9-11-25)18(27)14(2)3)21-12-16-6-7-17-23-22-15(4)26(17)13-16/h14,16H,5-13H2,1-4H3,(H,20,21) |
| InChIKey | OREHADNRZQRRBV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|