C13H24N6 — CID 119147119
1-butan-2-yl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine (PubChem CID 119147119) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-butan-2-yl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine.
| Compound Name | 1-butan-2-yl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119147119 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-butan-2-yl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
| SMILES | CCC(C)N/C(N)=N/CC1CCc2nnc(C)n2C1 |
| InChI | InChI=1S/C13H24N6/c1-4-9(2)16-13(14)15-7-11-5-6-12-18-17-10(3)19(12)8-11/h9,11H,4-8H2,1-3H3,(H3,14,15,16) |
| InChIKey | PACZOPCTPUPHAK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|