C20H34N6O — CID 119159118
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine (PubChem CID 119159118) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119159118 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethyl-2-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCc2nnc(C)n2C1)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C20H34N6O/c1-5-21-19(23-17-15-7-6-10-27-18(15)20(17,3)4)22-11-14-8-9-16-25-24-13(2)26(16)12-14/h14-15,17-18H,5-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | NNWCSNQOIKEYAX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|