C20H31ClIN3O2 — CID 119153146
2-[2-(3-chlorophenyl)-2-hydroxyethyl]-1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethylguanidine;hydroiodide (PubChem CID 119153146) has the molecular formula C20H31ClIN3O2 and a molecular weight of 507.84 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-hydroxyethyl]-1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-chlorophenyl)-2-hydroxyethyl]-1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153146 |
| Molecular Formula | C20H31ClIN3O2 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-hydroxyethyl]-1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(Cl)c1)NC1C2CCCOC2C1(C)C.I |
| InChI | InChI=1S/C20H30ClN3O2.HI/c1-4-22-19(23-12-16(25)13-7-5-8-14(21)11-13)24-17-15-9-6-10-26-18(15)20(17,2)3;/h5,7-8,11,15-18,25H,4,6,9-10,12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | AJKAGZNZLVYNCV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|