C19H30IN3O2 — CID 119153122
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-hydroxy-2-phenylethyl)guanidine;hydroiodide (PubChem CID 119153122) has the molecular formula C19H30IN3O2 and a molecular weight of 459.37 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-hydroxy-2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-hydroxy-2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119153122 |
| Molecular Formula | C19H30IN3O2 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-hydroxy-2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C19H29N3O2.HI/c1-4-20-18(21-12-15(23)13-8-6-5-7-9-13)22-16-14-10-11-24-17(14)19(16,2)3;/h5-9,14-17,23H,4,10-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | IBRZOTYHFWHNJT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|