C18H25F2N3O — CID 119162862
2-[(3,5-difluorophenyl)methyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine (PubChem CID 119162862) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 119162862 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(F)cc(F)c1)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C18H25F2N3O/c1-4-21-17(22-10-11-7-12(19)9-13(20)8-11)23-15-14-5-6-24-16(14)18(15,2)3/h7-9,14-16H,4-6,10H2,1-3H3,(H2,21,22,23) |
| InChIKey | OGVJJMDZXHPGCG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|