C14H28IN3O2 — CID 111755861
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 111755861) has the molecular formula C14H28IN3O2 and a molecular weight of 397.30 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111755861 |
| Molecular Formula | C14H28IN3O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOC)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C14H27N3O2.HI/c1-5-15-13(16-7-9-18-4)17-11-10-6-8-19-12(10)14(11,2)3;/h10-12H,5-9H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | JIPNZDUISNKRTG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|