C20H32IN3O2 — CID 111756115
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111756115) has the molecular formula C20H32IN3O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111756115 |
| Molecular Formula | C20H32IN3O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethyl-2-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccc(C)cc1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C20H31N3O2.HI/c1-5-21-19(22-11-13-24-15-8-6-14(2)7-9-15)23-17-16-10-12-25-18(16)20(17,3)4;/h6-9,16-18H,5,10-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | CDDRAQAJNNJVMG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|