C20H29N3O — CID 109396534
1-ethyl-2-[(3-methylphenyl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine (PubChem CID 109396534) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylphenyl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine.
| Compound Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
|---|---|
| PubChem CID | 109396534 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C20H29N3O/c1-3-21-19(22-13-15-7-4-6-14(2)12-15)23-17-16-8-11-24-18(16)20(17)9-5-10-20/h4,6-7,12,16-18H,3,5,8-11,13H2,1-2H3,(H2,21,22,23) |
| InChIKey | IIURXYPEWPXNOQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|