C19H28Cl2IN3O2 — CID 109492560
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine;hydroiodide (PubChem CID 109492560) has the molecular formula C19H28Cl2IN3O2 and a molecular weight of 528.26 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109492560 |
| Molecular Formula | C19H28Cl2IN3O2 |
| Molecular Weight | 528.26 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C19H27Cl2N3O2.HI/c1-4-22-18(24-16-14-5-6-26-17(14)19(16,2)3)23-10-15(25)11-7-12(20)9-13(21)8-11;/h7-9,14-17,25H,4-6,10H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | BAPBYBLPILHJAA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|