C15H22Cl2IN3O — CID 109492515
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 109492515) has the molecular formula C15H22Cl2IN3O and a molecular weight of 458.17 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492515 |
| Molecular Formula | C15H22Cl2IN3O |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NC1CC1C.I |
| InChI | InChI=1S/C15H21Cl2N3O.HI/c1-3-18-15(20-13-4-9(13)2)19-8-14(21)10-5-11(16)7-12(17)6-10;/h5-7,9,13-14,21H,3-4,8H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | XBZUKUFOVLQDAJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|