C17H26Cl2N4O2 — CID 109492313
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 109492313) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109492313 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCC1CN(C)CCO1 |
| InChI | InChI=1S/C17H26Cl2N4O2/c1-3-20-17(21-9-15-11-23(2)4-5-25-15)22-10-16(24)12-6-13(18)8-14(19)7-12/h6-8,15-16,24H,3-5,9-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | FSAVXJRNJNHDBL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|