C20H28Cl2IN3O2 — CID 109492721
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide (PubChem CID 109492721) has the molecular formula C20H28Cl2IN3O2 and a molecular weight of 540.27 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109492721 |
| Molecular Formula | C20H28Cl2IN3O2 |
| Molecular Weight | 540.27 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NC1C2CCOC2C12CCC2.I |
| InChI | InChI=1S/C20H27Cl2N3O2.HI/c1-2-23-19(24-11-16(26)12-8-13(21)10-14(22)9-12)25-17-15-4-7-27-18(15)20(17)5-3-6-20;/h8-10,15-18,26H,2-7,11H2,1H3,(H2,23,24,25);1H |
| InChIKey | SZNNOVMFFNXNKU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|