C19H30IN3OS — CID 109393681
1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 109393681) has the molecular formula C19H30IN3OS and a molecular weight of 475.44 g/mol. Its IUPAC name is 1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109393681 |
| Molecular Formula | C19H30IN3OS |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NC1C2CCOC2C12CCC2.I |
| InChI | InChI=1S/C19H29N3OS.HI/c1-3-20-18(21-11-13(2)14-6-10-24-12-14)22-16-15-5-9-23-17(15)19(16)7-4-8-19;/h6,10,12-13,15-17H,3-5,7-9,11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | HNRRHKOXFQKBRN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|