C24H38IN3O3 — CID 109494006
1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109494006) has the molecular formula C24H38IN3O3 and a molecular weight of 543.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109494006 |
| Molecular Formula | C24H38IN3O3 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C24H37N3O3.HI/c1-4-25-23(26-15-20(28)17-7-9-18(10-8-17)30-16(2)3)27-21-19-11-14-29-22(19)24(21)12-5-6-13-24;/h7-10,16,19-22,28H,4-6,11-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | SIGVHWHNLDZCPN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|