C20H32IN3O2S — CID 109404232
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109404232) has the molecular formula C20H32IN3O2S and a molecular weight of 505.47 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109404232 |
| Molecular Formula | C20H32IN3O2S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C20H31N3O2S.HI/c1-3-21-18(22-13-19(2,24)14-7-11-26-12-14)23-16-15-6-10-25-17(15)20(16)8-4-5-9-20;/h7,11-12,15-17,24H,3-6,8-10,13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | PTFXOFCAYBVIMH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|